logo
Home  > 2-Aminoquinoline-7-carboxylic acid

AE27332

1092287-45-0 | 2-Aminoquinoline-7-carboxylic acid

Packsize Purity Availability Price Discounted Price    Quantity
100mg 97% in stock $40.00 $28.00 -   +
250mg 97% in stock $96.00 $68.00 -   +
1g 97% in stock $383.00 $269.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AE27332
Chemical Name: 2-Aminoquinoline-7-carboxylic acid
CAS Number: 1092287-45-0
Molecular Formula: C10H8N2O2
Molecular Weight: 188.1827
MDL Number: MFCD18250521
SMILES: Nc1ccc2c(n1)cc(cc2)C(=O)O

 

Upstream Synthesis Route 
  • The versatile compound 2-Aminoquinoline-7-carboxylic acid plays a crucial role in chemical synthesis as a key building block for diverse organic molecules. With its unique structure and reactivity, this compound is widely utilized in the pharmaceutical industry for the synthesis of novel drugs and therapeutic agents. Its amino and carboxylic acid functional groups enable it to participate in a variety of important chemical reactions, such as amidation, esterification, and condensation reactions. Additionally, 2-Aminoquinoline-7-carboxylic acid serves as a valuable precursor for the preparation of heterocyclic compounds, which are essential in drug discovery and development. Its significance in synthesis lies in its ability to introduce specific functional groups and structural motifs into organic molecules, allowing for the creation of compounds with desired pharmacological properties.
FEATURED PRODUCTS