logo
Home  > tert-Butyl 4-ethynyl-1h-pyrazole-1-carboxylate

AE31857

1093193-29-3 | tert-Butyl 4-ethynyl-1h-pyrazole-1-carboxylate

Packsize Purity Availability Price Discounted Price    Quantity
250mg 97% in stock $228.00 $159.00 -   +
1g 97% in stock $533.00 $373.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AE31857
Chemical Name: tert-Butyl 4-ethynyl-1h-pyrazole-1-carboxylate
CAS Number: 1093193-29-3
Molecular Formula: C10H12N2O2
Molecular Weight: 192.2145
MDL Number: MFCD16293741
SMILES: C#Cc1cnn(c1)C(=O)OC(C)(C)C

 

Upstream Synthesis Route 
  • The tert-Butyl 4-ethynyl-1H-pyrazole-1-carboxylate is a versatile compound used in various chemical synthesis reactions. Its acetylenic group provides a unique reactivity, allowing for the formation of novel organic molecules and complex structures. This compound is particularly valuable in the preparation of pharmaceutical intermediates, agrochemicals, and materials with specialized properties. Its presence in the synthesis process can lead to the creation of compounds with enhanced biological activity or desired physical characteristics. Additionally, tert-Butyl 4-ethynyl-1H-pyrazole-1-carboxylate serves as a valuable building block in the development of new materials for applications in fields such as medicine, agriculture, and materials science.
FEATURED PRODUCTS