AE11334
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 97% | in stock | $57.00 | $40.00 | - + | |
25mg | 97% | in stock | $160.00 | $112.00 | - + | |
100mg | 97% | in stock | $219.00 | $153.00 | - + | |
250mg | 97% | in stock | $356.00 | $249.00 | - + | |
1g | 97% | in stock | $1,070.00 | $749.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE11334 |
Chemical Name: | 4-Methyl-N-(2-(3-(morpholinomethyl)imidazo[2,1-b]thiazol-6-yl)phenyl)-2-(pyridin-3-yl)thiazole-5-carboxamide |
CAS Number: | 1093403-33-8 |
Molecular Formula: | C26H24N6O2S2 |
Molecular Weight: | 516.6377599999998 |
MDL Number: | MFCD22572733 |
SMILES: | O=C(c1sc(nc1C)c1cccnc1)Nc1ccccc1c1cn2c(n1)scc2CN1CCOCC1 |
Complexity: | 758 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 36 |
Hydrogen Bond Acceptor Count: | 8 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 6 |
XLogP3: | 4.2 |
4-Methyl-N-[2-[3-(4-morpholinylmethyl)imidazo[2,1-b]thiazol-6-yl]phenyl]-2-(3-pyridinyl)-5-thiazolecarboxamide is a versatile compound commonly used in chemical synthesis as a key building block for the preparation of novel pharmaceutical agents, agrochemicals, and fluorescent dyes. Its unique structure containing multiple functional groups allows for efficient derivatization and incorporation into diverse molecular frameworks. In organic synthesis, this compound serves as a valuable intermediate for the synthesis of potent bioactive molecules through various synthetic routes, enabling the development of new therapeutic agents and research tools.
Inflammatory bowel diseases 20160301
PloS one 20150101
Annals of clinical and translational neurology 20141201
Aging cell 20141001
British journal of clinical pharmacology 20140701