AB79477
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $41.00 | $29.00 | - + | |
5g | 95% | in stock | $98.00 | $69.00 | - + | |
25g | 95% | in stock | $123.00 | $86.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB79477 |
Chemical Name: | Tetrabutylphosphonium benzotriazolate |
CAS Number: | 109348-55-2 |
Molecular Formula: | C22H40N3P |
Molecular Weight: | 377.5469 |
MDL Number: | MFCD04038148 |
SMILES: | c1ccc2c(c1)nn[n-]2.CCCC[P+](CCCC)(CCCC)CCCC |
Tetrabutylphosphonium benzo[d][1,2,3]triazol-1-ide serves as a versatile reagent in chemical synthesis, particularly in the realm of organic chemistry. With its unique structure and properties, this compound is highly valued in the development of various organic transformations and reactions. Its ability to participate in multiple synthetic pathways makes it a valuable tool for chemists working in the field of drug discovery, materials science, and beyond. Whether employed as a catalyst, a reagent in cross-coupling reactions, or in the synthesis of heterocyclic compounds, Tetrabutylphosphonium benzo[d][1,2,3]triazol-1-ide demonstrates its utility in advancing the frontiers of modern chemical synthesis.