logo
Home  > 1H-Imidazole, 1-(4-ethynyl-2-methoxyphenyl)-4-methyl-

AE11024

1093980-57-4 | 1H-Imidazole, 1-(4-ethynyl-2-methoxyphenyl)-4-methyl-

Packsize Purity Availability Price Discounted Price    Quantity
100mg 98% in stock $240.00 $168.00 -   +
500mg 98% in stock $769.00 $539.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AE11024
Chemical Name: 1H-Imidazole, 1-(4-ethynyl-2-methoxyphenyl)-4-methyl-
CAS Number: 1093980-57-4
Molecular Formula: C13H12N2O
Molecular Weight: 212.2472
MDL Number: MFCD12545876
SMILES: COc1cc(C#C)ccc1n1cnc(c1)C

 

Upstream Synthesis Route 
  • 1H-Imidazole, 1-(4-ethynyl-2-methoxyphenyl)-4-methyl- is a versatile compound widely utilized in chemical synthesis due to its unique properties. This compound serves as a valuable building block in the synthesis of various organic molecules, particularly in the development of pharmaceuticals and agrochemicals. Its specific structure enables it to participate in a range of chemical reactions, making it a crucial intermediate in the production of complex organic molecules. When utilized in chemical synthesis, this compound plays a key role in the creation of novel compounds with diverse applications across various industries.
FEATURED PRODUCTS