logo
Home  > SCH-1473759 hydrochloride

AE11464

1094067-13-6 | SCH-1473759 hydrochloride

Packsize Purity Availability Price Discounted Price    Quantity
2mg 95% 1 week $125.00 $88.00 -   +
10mg 95% 1 week $599.00 $419.00 -   +
50mg 95% 1 week $1,336.00 $935.00 -   +
100mg 95% 1 week $2,022.00 $1,415.00 -   +
200mg 95% 1 week $3,445.00 $2,411.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AE11464
Chemical Name: SCH-1473759 hydrochloride
CAS Number: 1094067-13-6
Molecular Formula: C20H27ClN8OS
Molecular Weight: 462.99938
MDL Number: MFCD18251447
SMILES: CCN(C(CO)(C)C)Cc1nsc(c1)Nc1nc(C)cn2c1ncc2c1c[nH]nc1.Cl

 

Upstream Synthesis Route
  • The compound $name$ plays a crucial role in chemical synthesis as it serves as a versatile building block for the creation of diverse organic molecules. This compound's unique structure, which combines multiple functional groups such as amino, imidazo, and isothiazol, enables it to participate in a wide range of chemical reactions, facilitating the synthesis of complex molecules with specific properties.In organic synthesis, $name$ can be employed as a key intermediate in the preparation of pharmaceuticals, agrochemicals, and materials with tailored functionalities. Its ethyl, methyl, and hydroxyl groups can serve as anchoring points for further chemical modifications, allowing chemists to introduce specific substituents or structural motifs to fine-tune the properties of the final product.Furthermore, the presence of the pyrazol and imidazo rings in $name$ offers opportunities for the construction of heterocyclic compounds, which are prevalent in medicinal chemistry and drug discovery. By leveraging the structural features of $name$, chemists can access diverse chemical space and explore new pathways for the synthesis of biologically active molecules.Overall, the strategic use of $name$ in chemical synthesis enables researchers to access complex molecular scaffolds with precision and efficiency, advancing the development of novel compounds for various applications.
FEATURED PRODUCTS