logo
Home  > N-(4-Methylsulphonyl-3-nitrophenyl)piperazine

AB76529

1095010-43-7 | N-(4-Methylsulphonyl-3-nitrophenyl)piperazine

Packsize Purity Availability Price Discounted Price    Quantity
1g 97% in stock $401.00 $281.00 -   +
5g 97% in stock $1,100.00 $770.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AB76529
Chemical Name: N-(4-Methylsulphonyl-3-nitrophenyl)piperazine
CAS Number: 1095010-43-7
Molecular Formula: C11H15N3O4S
Molecular Weight: 285.3195
MDL Number: MFCD10568172
SMILES: [O-][N+](=O)c1cc(ccc1S(=O)(=O)C)N1CCNCC1

 

Upstream Synthesis Route 
  • N-(4-Methylsulphonyl-3-nitrophenyl)piperazine is a versatile compound commonly utilized in chemical synthesis as a key intermediate. This molecule is widely employed in the pharmaceutical and agrochemical industries for the production of various active ingredients and compounds. It serves as a crucial building block in the synthesis of complex organic molecules due to its unique structural properties and reactivity. N-(4-Methylsulphonyl-3-nitrophenyl)piperazine plays a pivotal role in the creation of novel drug candidates, pesticides, and other biologically active substances. Its strategic incorporation in chemical reactions enables the efficient formation of diverse chemical structures, making it an essential tool in modern organic synthesis methodologies.
FEATURED PRODUCTS