AI07985
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $15.00 | $10.00 | - + | |
25mg | 98% | in stock | $19.00 | $13.00 | - + | |
100mg | 98% | in stock | $23.00 | $16.00 | - + | |
1g | 98% | in stock | $25.00 | $18.00 | - + | |
5g | 98% | in stock | $50.00 | $35.00 | - + | |
25g | 98% | in stock | $171.00 | $120.00 | - + | |
100g | 98% | in stock | $573.00 | $402.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI07985 |
Chemical Name: | Pyrithioxin |
CAS Number: | 1098-97-1 |
Molecular Formula: | C16H20N2O4S2 |
Molecular Weight: | 368.471 |
MDL Number: | MFCD00151477 |
SMILES: | OCc1c(CSSCc2cnc(c(c2CO)O)C)cnc(c1O)C |
NSC Number: | 759229 |
Complexity: | 346 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 24 |
Hydrogen Bond Acceptor Count: | 8 |
Hydrogen Bond Donor Count: | 4 |
Rotatable Bond Count: | 7 |
XLogP3: | 1.2 |
Pyrithioxin, also known as 1,4-dihydroxy-2,5-diethylthio benzene, is a versatile compound widely used in chemical synthesis. Its unique structure and properties make it a valuable tool in various reactions and processes in the field of chemistry.In chemical synthesis, Pyrithioxin serves as an essential building block for creating diverse organic compounds. Its thioether functional group enables it to participate in thiol-based reactions, such as thiol-ene and thiol-Michael additions, leading to the formation of new carbon-sulfur bonds. This characteristic makes Pyrithioxin a valuable reagent for constructing complex molecular structures in organic synthesis.Additionally, Pyrithioxin's dihydroxy benzene moiety can undergo various functionalization reactions, such as electrophilic aromatic substitutions and oxidative coupling reactions. These transformations enable the incorporation of Pyrithioxin into larger molecular frameworks, allowing for the synthesis of novel compounds with tailored properties and functionalities.Furthermore, Pyrithioxin's ability to undergo redox reactions makes it a versatile reagent for catalyzing oxidation-reduction processes in chemical synthesis. Its redox-active nature allows for the transfer of electrons during reactions, facilitating the conversion of substrates into desired products with high efficiency and selectivity.Overall, Pyrithioxin plays a crucial role in chemical synthesis by serving as a key building block, catalyst, and reagent for creating a wide range of organic compounds with diverse structures and functionalities. Its unique properties make it a valuable tool for researchers and chemists working in various fields, including medicinal chemistry, materials science, and drug discovery.
Frontiers in aging neuroscience 20100101
Drug testing and analysis 20090501
Indian pediatrics 20090101
Journal of medicinal chemistry 20081113
European journal of pharmacology 20080820
Yakugaku zasshi : Journal of the Pharmaceutical Society of Japan 20070101
Journal of AOAC International 20050101
Annals of the New York Academy of Sciences 20040601
BMJ (Clinical research ed.) 20040306
Vestnik Rossiiskoi akademii meditsinskikh nauk 20010101
Methods and findings in experimental and clinical pharmacology 19880701