AD45071
Availability | ||
---|---|---|
Typically In Stock |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD45071 |
Chemical Name: | Tautomycin |
CAS Number: | 109946-35-2 |
Molecular Formula: | C41H66O13 |
Molecular Weight: | 766.9549 |
SMILES: | CO[C@@H]([C@@H](C(C)C)OC(=O)C[C@H](C1=C(C)C(=O)OC1=O)O)[C@@H](CC(=O)[C@H]([C@H](CC[C@H]([C@@H]1O[C@@]2(CC[C@@H]1C)CC[C@H]([C@@H](O2)CC[C@@H](C(=O)C)C)C)C)O)C)O |
Tautomycin is a potent natural product that has shown significant utility in chemical synthesis, particularly in the development of new therapeutic agents and bioactive compounds. Its unique structure and reactivity make it a valuable tool for chemists seeking to design and synthesize complex organic molecules.In chemical synthesis, Tautomycin can be utilized as a key building block or as a precursor for the construction of more elaborate molecular structures. Its ability to undergo specific chemical reactions, such as selective functional group transformations and stereospecific bond formations, makes it an essential reagent in the arsenal of synthetic chemists.Furthermore, the diverse reactivity of Tautomycin allows for the introduction of specific chemical functionalities into target molecules, enabling the fine-tuning of their properties and biological activities. By strategically incorporating Tautomycin into synthetic pathways, chemists can access a wide range of structurally diverse compounds with potential pharmaceutical applications.Overall, the application of Tautomycin in chemical synthesis opens up new avenues for the efficient and controlled construction of complex molecules with tailored functionalities, offering exciting opportunities for drug discovery and materials science research.