AD67803
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
25g | 95% | 1 week | $18.00 | $12.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD67803 |
Chemical Name: | 1,3-Dimethyl-5-phenoxy-1H-pyrazole-4-carbaldehyde oxime |
CAS Number: | 110035-28-4 |
Molecular Formula: | C12H13N3O2 |
Molecular Weight: | 231.2505 |
MDL Number: | MFCD03762232 |
SMILES: | O/N=C/c1c(C)nn(c1Oc1ccccc1)C |
1,3-Dimethyl-5-phenoxy-1H-pyrazole-4-carbaldehyde oxime is a versatile compound widely utilized in chemical synthesis. This compound serves as a valuable building block in the creation of various organic molecules due to its unique structural properties. Specifically, it is commonly employed as a key intermediate in the development of pharmaceuticals, agrochemicals, and other specialty chemicals. By leveraging the reactivity of the aldehyde and oxime functional groups, this compound can participate in a range of important reactions such as condensations, cycloadditions, and heterocyclic formations. Its ability to act as a precursor for the introduction of diverse functional groups makes it a valuable tool for synthetic chemists seeking to access complex molecular structures efficiently. Furthermore, its specific configuration offers opportunities for stereochemical control, enabling the synthesis of enantiomerically pure compounds with high levels of selectivity. In summary, 1,3-Dimethyl-5-phenoxy-1H-pyrazole-4-carbaldehyde oxime plays a crucial role in advancing the frontier of chemical synthesis by enabling the construction of intricate molecules with significant synthetic and biological relevance.