AB53574
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
10mg | 99% | 1 week | $274.00 | $192.00 | - + | |
100mg | 99% | 1 week | $1,526.00 | $1,068.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB53574 |
Chemical Name: | (3S,4R,5S,8R,9E,12S,14S,15R,16S,18R,19R,26aS)-8-Ethyl-5,6,8,11,12,13,14,15,16,17,18,19,24,25,26,26a-hexadecahydro-5,19-dihydroxy-3-[(1E)-2-[(1R,3R,4R)-4-hydroxy-3-methoxycyclohexyl]-1-methylethenyl]-14,16-dimethoxy-4,10,12,18-tetramethyl-15,19-epoxy-3H-pyrido[2,1-c][1,4]oxaazacyclotricosine-1,7,20,21(4H,23H)-tetrone |
CAS Number: | 11011-38-4 |
Molecular Formula: | C43H69NO12 |
Molecular Weight: | 792.0074600000007 |
MDL Number: | MFCD06198665 |
SMILES: | CC[C@@H]1/C=C(\C)/C[C@H](C)C[C@H](OC)[C@H]2O[C@](O)([C@@H](C[C@@H]2OC)C)C(=O)C(=O)N2[C@H](C(=O)O[C@@H]([C@@H]([C@H](CC1=O)O)C)C(=C[C@@H]1CC[C@H]([C@@H](C1)OC)O)C)CCCC2 |
The compound (3S,4R,5S,8R,9E,12S,14S,15R,16S,18R,19R,26aS)-8-Ethyl-5,6,8,11,12,13,14,15,16,17,18,19,24,25,26,26a-hexadecahydro-5,19-dihydroxy-3-[(1E)-2-[(1R,3R,4R)-4-hydroxy-3-methoxycyclohexyl]-1-methylethenyl]-14,16-dimethoxy-4,10,12,18-tetramethyl-15,19-epoxy-3H-pyrido[2,1-c][1,4]oxaazacyclotricosine-1,7,20,21(4H,23H)-tetrone plays a vital role in chemical synthesis processes. It serves as a key building block in the creation of various complex organic molecules due to its unique structural features and functional groups. Its intricate framework enables precise manipulation of stereochemistry and regioselectivity in synthetic pathways, making it a valuable tool for chemists in the design and assembly of specialized compounds for pharmaceuticals, materials, and other applications.