AE52728
Availability | ||
---|---|---|
Typically In Stock |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE52728 |
Chemical Name: | HERBACETIN 8-O-GLUCOSIDE |
CAS Number: | 11021-22-0 |
Molecular Formula: | C21H20O12 |
Molecular Weight: | 464.3763 |
SMILES: | C1=CC(=CC=C1C2=C(C(=O)C3=C(O2)C(=C(C=C3O)O)OC4C(C(C(C(O4)CO)O)O)O)O)O |
Herbacetin 8-O-β-D-glucopyranoside, a naturally occurring flavonoid glycoside, holds significant potential in chemical synthesis as a versatile building block for creating diverse chemical compounds. In the realm of synthetic chemistry, this compound serves as a valuable precursor for the synthesis of various bioactive molecules and pharmaceutical agents. Its unique structure and reactivity make it a key player in the development of innovative synthetic routes, allowing chemists to access complex molecular architectures efficiently. By leveraging the synthetic capabilities of Herbacetin 8-O-β-D-glucopyranoside, researchers can explore new pathways for the construction of novel compounds with potential application in drug discovery, material science, and other interdisciplinary fields.