AE15524
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
25mg | 1 week | $1,248.00 | $874.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE15524 |
Chemical Name: | Calcium (3R,5R)-7-[[(3R,5R)-7-[2-(4-fluorophenyl)-5-(1-methylethyl)-3-phenyl-4-[(phenylamino)carbonyl]-1H-pyrrol-1-yl]-3,5-dihydroxy-1-oxoheptyl]amino]-3,5-dihydroxyheptanoate |
CAS Number: | 1105067-87-5 |
Molecular Formula: | C80H94CaF2N6O16 |
Molecular Weight: | 1473.707766400001 |
MDL Number: | MFCD00007303 |
SMILES: | O[C@@H](C[C@H](CC(=O)NCC[C@H](C[C@H](CC(=O)[O-])O)O)O)CCn1c(c2ccc(cc2)F)c(c(c1C(C)C)C(=O)Nc1ccccc1)c1ccccc1.O[C@@H](C[C@H](CC(=O)NCC[C@H](C[C@H](CC(=O)[O-])O)O)O)CCn1c(c2ccc(cc2)F)c(c(c1C(C)C)C(=O)Nc1ccccc1)c1ccccc1.[Ca+2] |
Atorvastatin N-(3,5-Dihydroxy-7-heptanoic Acid)amide is a crucial intermediate compound in chemical synthesis processes. This specific compound plays a significant role in the creation of pharmaceutical products, specifically in the development of medications aimed at treating cardiovascular diseases. With its unique chemical structure, Atorvastatin N-(3,5-Dihydroxy-7-heptanoic Acid)amide serves as a key building block in the synthesis of Atorvastatin, a widely used drug for lowering cholesterol levels and preventing heart-related conditions. In the realm of chemical synthesis, this compound serves as a crucial link in the chain of reactions that lead to the final formulation of pharmaceuticals designed to improve cardiovascular health and overall well-being.