AE14086
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
2.5mg | 3 weeks | $379.00 | $265.00 | - + | ||
25mg | 3 weeks | $1,866.00 | $1,306.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE14086 |
Chemical Name: | 10-trans-Atorvastatin Acetonide tert-Butyl Ester |
CAS Number: | 1105067-90-0 |
Molecular Formula: | C40H47FN2O5 |
Molecular Weight: | 654.81 |
SMILES: | O=C(OC(C)(C)C)C[C@@H]1C[C@@H](CCn2c(C(C)C)c(c(c2c2ccc(cc2)F)c2ccccc2)C(=O)Nc2ccccc2)OC(O1)(C)C |
The compound 1,1-Dimethylethyl (4S,6R)-6-[2-[2-(4-fluorophenyl)-5-(1-methylethyl)-3-phenyl-4-[(phenylamino)carbonyl]-1H-pyrrol-1-yl]ethyl]-2,2-dimethyl-1,3-dioxane-4-acetate is a key reagent used in chemical synthesis. This compound plays a crucial role in organic chemistry reactions due to its unique structural features. It can serve as a versatile building block in the creation of complex organic molecules with specific stereochemical configurations. Its presence can significantly influence the outcome and efficiency of various synthetic processes, making it an essential tool for chemists working in the field of drug discovery, material science, and other areas requiring precise chemical synthesis.