AD77784
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $44.00 | $31.00 | - + | |
1g | 95% | in stock | $113.00 | $79.00 | - + | |
5g | 95% | in stock | $464.00 | $325.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD77784 |
Chemical Name: | (1S,2R,3S,5R)-3-(Benzyloxy)-2-((benzyloxy)methyl)-6-oxabicyclo[3.1.0]hexane |
CAS Number: | 110567-22-1 |
Molecular Formula: | C20H22O3 |
Molecular Weight: | 310.3869 |
MDL Number: | MFCD09750952 |
SMILES: | c1ccc(cc1)COC[C@@H]1[C@@H](OCc2ccccc2)C[C@@H]2[C@H]1O2 |
Complexity: | 360 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 4 |
Heavy Atom Count: | 23 |
Hydrogen Bond Acceptor Count: | 3 |
Rotatable Bond Count: | 7 |
XLogP3: | 3.1 |
The compound (1S,2R,3S,5R)-3-(Benzyloxy)-2-((benzyloxy)methyl)-6-oxabicyclo[3.1.0]hexane plays a crucial role in chemical synthesis due to its unique structural features. This molecule serves as a versatile building block in organic chemistry, particularly in the synthesis of complex organic compounds. Its bicyclic structure provides a rigid framework for selective chemical reactions, making it a valuable intermediate in the creation of various pharmaceuticals, agrochemicals, and materials.In chemical synthesis, (1S,2R,3S,5R)-3-(Benzyloxy)-2-((benzyloxy)methyl)-6-oxabicyclo[3.1.0]hexane can undergo different functional group transformations, such as protecting group manipulations, ring-opening reactions, and cycloadditions. These reactions allow for the modification and diversification of the molecule, enabling the creation of novel organic molecules with specific properties and functionalities. Additionally, the presence of benzyl ether groups in the compound offers stability during synthetic transformations while being readily removable under mild conditions, making it a valuable tool in organic synthesis strategies.Overall, the strategic incorporation of (1S,2R,3S,5R)-3-(Benzyloxy)-2-((benzyloxy)methyl)-6-oxabicyclo[3.1.0]hexane in chemical synthesis facilitates the construction of intricate molecular architectures with high efficiency and precision, making it a valuable asset in the toolbox of synthetic chemists.