AE09373
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $42.00 | $29.00 | - + | |
250mg | 95% | in stock | $44.00 | $31.00 | - + | |
1g | 95% | in stock | $121.00 | $85.00 | - + | |
5g | 95% | in stock | $472.00 | $330.00 | - + | |
25g | 95% | in stock | $1,831.00 | $1,282.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE09373 |
Chemical Name: | 1,4-Dioxaspiro[4.5]decane-8-boronic acid pinacol ester |
CAS Number: | 1106871-37-7 |
Molecular Formula: | C14H25BO4 |
Molecular Weight: | 268.1569 |
MDL Number: | MFCD14581935 |
SMILES: | CC1(C)OB(OC1(C)C)C1CCC2(CC1)OCCO2 |
Complexity: | 323 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 19 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 1 |
4,4,5,5-Tetramethyl-2-(1,4-dioxaspiro[4.5]decan-8-yl)-1,3,2-dioxaborolane serves as a valuable building block in chemical synthesis due to its unique structure and reactivity. Its boron-containing core provides a versatile platform for forming various carbon-carbon and carbon-heteroatom bonds. In organic synthesis, this compound can be employed as a boron source in Suzuki-Miyaura cross-coupling reactions to introduce aryl or vinyl groups onto organic molecules under mild conditions. Additionally, the spirocyclic moiety can act as a stereochemical control element, influencing the configuration of adjacent stereocenters in complex molecule assembly. Its compact and rigid structure makes it particularly useful in the construction of chiral ligands, pharmaceutical intermediates, and other fine chemicals where precise spatial arrangement is crucial for desired properties and activities.