logo
Home  > 1-Phthalazineaceticacid, 3,4-dihydro-4-oxo-3-[[5-(trifluoromethyl)-2-benzothiazolyl]methyl]-

AD77573

110703-94-1 | 1-Phthalazineaceticacid, 3,4-dihydro-4-oxo-3-[[5-(trifluoromethyl)-2-benzothiazolyl]methyl]-

Packsize Purity Availability Price Discounted Price    Quantity
1mg 98% in stock $42.00 $29.00 -   +
10mg 98% in stock $142.00 $99.00 -   +
25mg 98% in stock $293.00 $205.00 -   +
50mg 98% in stock $470.00 $329.00 -   +
100mg 98% in stock $780.00 $546.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AD77573
Chemical Name: 1-Phthalazineaceticacid, 3,4-dihydro-4-oxo-3-[[5-(trifluoromethyl)-2-benzothiazolyl]methyl]-
CAS Number: 110703-94-1
Molecular Formula: C19H12F3N3O3S
Molecular Weight: 419.3770896
MDL Number: MFCD00865476
SMILES: OC(=O)Cc1nn(Cc2nc3c(s2)ccc(c3)C(F)(F)F)c(=O)c2c1cccc2

 

Upstream Synthesis Route 
  • The compound 1-Phthalazineacetic acid, 3,4-dihydro-4-oxo-3-[[5-(trifluoromethyl)-2-benzothiazolyl]methyl] serves as a valuable building block in chemical synthesis due to its versatile reactivity and unique structural features. When used in chemical reactions, this compound acts as a key intermediate in the synthesis of various pharmaceuticals, agrochemicals, and other fine chemicals. Its functional groups and molecular structure make it a valuable precursor for the formation of complex molecules with specific biological activities or physical properties. This compound's role in chemical synthesis highlights its significance in the development of new materials and compounds with potential applications in various fields of science and industry.
FEATURED PRODUCTS