AB79192
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $15.00 | $10.00 | - + | |
1g | 95% | in stock | $16.00 | $11.00 | - + | |
5g | 95% | in stock | $19.00 | $13.00 | - + | |
25g | 95% | in stock | $24.00 | $17.00 | - + | |
50g | 95% | in stock | $42.00 | $29.00 | - + | |
100g | 95% | in stock | $54.00 | $38.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB79192 |
Chemical Name: | Squalene |
CAS Number: | 111-02-4 |
Molecular Formula: | C30H50 |
Molecular Weight: | 410.718 |
MDL Number: | MFCD00008912 |
SMILES: | CC(=CCCC=C(CCC=C(CCC=C(C)C)C)C)CCC=C(CCC=C(C)C)C |
Squalene, a natural organic compound found in high concentrations in shark liver oil, olive oil, and certain plants, is an important component in chemical synthesis. This naturally occurring compound serves as a precursor to the biosynthesis of sterols, such as cholesterol, and other important biochemical molecules in living organisms. In chemical synthesis, squalene is utilized for its valuable properties as a stable, nonpolar hydrocarbon that can undergo various chemical reactions to yield structurally diverse compounds.One of the key applications of squalene in chemical synthesis is its role as a feedstock for the production of specialized chemicals and pharmaceuticals. Its hydrocarbon structure allows for versatile chemical modifications, making it an attractive starting material for the synthesis of complex organic molecules. Through processes such as hydrogenation, oxidation, and functional group transformations, squalene can be transformed into a wide range of intermediates and final products with diverse functionalities and applications.Moreover, squalene's unique properties, such as its high purity and stability, make it a desirable reagent for carrying out specific chemical reactions with precision and efficiency. Its incorporation into synthetic pathways enables chemists to access new compounds that may have potential therapeutic, industrial, or research applications. Overall, squalene plays a crucial role in modern chemical synthesis by serving as a versatile building block for the creation of novel molecules with tailored properties and functionalities.