logo
Home  > Inhibitors/Agonists  > Immunology/Inflammation  > Thrombopoietin Receptor  > (S,E)-3-(2,6-Dichloro-4-((4-(3-(1-(hexyloxy)ethyl)-2-methoxyphenyl)thiazol-2-yl)carbamoyl)phenyl)-2-methylacrylic acid

AE19521

1110766-97-6 | (S,E)-3-(2,6-Dichloro-4-((4-(3-(1-(hexyloxy)ethyl)-2-methoxyphenyl)thiazol-2-yl)carbamoyl)phenyl)-2-methylacrylic acid

Packsize Purity Availability Price Discounted Price    Quantity
1mg 97% in stock $19.00 $13.00 -   +
2mg 97% in stock $24.00 $17.00 -   +
5mg 97% in stock $39.00 $27.00 -   +
50mg 97% in stock $159.00 $111.00 -   +
100mg 97% in stock $257.00 $180.00 -   +
250mg 97% in stock $434.00 $304.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AE19521
Chemical Name: (S,E)-3-(2,6-Dichloro-4-((4-(3-(1-(hexyloxy)ethyl)-2-methoxyphenyl)thiazol-2-yl)carbamoyl)phenyl)-2-methylacrylic acid
CAS Number: 1110766-97-6
Molecular Formula: C29H32Cl2N2O5S
Molecular Weight: 591.5458
MDL Number: MFCD28502075
SMILES: CCCCCCO[C@H](c1cccc(c1OC)c1csc(n1)NC(=O)c1cc(Cl)c(c(c1)Cl)/C=C(/C(=O)O)\C)C

 

Computed Properties
Complexity: 822  
Covalently-Bonded Unit Count: 1  
Defined Atom Stereocenter Count: 1  
Defined Bond Stereocenter Count: 1  
Heavy Atom Count: 39  
Hydrogen Bond Acceptor Count: 7  
Hydrogen Bond Donor Count: 2  
Rotatable Bond Count: 13  
XLogP3: 7.7  

 

 

Upstream Synthesis Route
  • 2-Propenoic acid, 3-[2,6-dichloro-4-[[[4-[3-[(1S)-1-(hexyloxy)ethyl]-2-methoxyphenyl]-2-thiazolyl]amino]carbonyl]phenyl]-2-methyl-, (2E)- is a versatile compound widely used in chemical synthesis due to its unique structure and reactivity. Its application in synthesis plays a crucial role in creating complex organic molecules with specific properties and functions.This compound serves as a key building block in the preparation of various pharmaceuticals, agrochemicals, and functional materials. Its presence in chemical reactions allows for the introduction of specific functionalities and structural motifs, leading to the formation of novel compounds with tailored properties.In chemical synthesis, 2-Propenoic acid, 3-[2,6-dichloro-4-[[[4-[3-[(1S)-1-(hexyloxy)ethyl]-2-methoxyphenyl]-2-thiazolyl]amino]carbonyl]phenyl]-2-methyl-, (2E)- acts as a strategic intermediate that undergoes diverse transformations to yield desired products. Its reactivity with various reagents and catalytic systems enables the construction of intricate molecular frameworks and the synthesis of complex molecules with high efficiency.Overall, the use of 2-Propenoic acid, 3-[2,6-dichloro-4-[[[4-[3-[(1S)-1-(hexyloxy)ethyl]-2-methoxyphenyl]-2-thiazolyl]amino]carbonyl]phenyl]-2-methyl-, (2E)- in chemical synthesis is vital for the development of innovative materials, pharmaceuticals, and functional molecules that have a wide range of applications in different industries.
Literature
FEATURED PRODUCTS