AE19521
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 97% | in stock | $19.00 | $13.00 | - + | |
2mg | 97% | in stock | $24.00 | $17.00 | - + | |
5mg | 97% | in stock | $39.00 | $27.00 | - + | |
50mg | 97% | in stock | $159.00 | $111.00 | - + | |
100mg | 97% | in stock | $257.00 | $180.00 | - + | |
250mg | 97% | in stock | $434.00 | $304.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE19521 |
Chemical Name: | (S,E)-3-(2,6-Dichloro-4-((4-(3-(1-(hexyloxy)ethyl)-2-methoxyphenyl)thiazol-2-yl)carbamoyl)phenyl)-2-methylacrylic acid |
CAS Number: | 1110766-97-6 |
Molecular Formula: | C29H32Cl2N2O5S |
Molecular Weight: | 591.5458 |
MDL Number: | MFCD28502075 |
SMILES: | CCCCCCO[C@H](c1cccc(c1OC)c1csc(n1)NC(=O)c1cc(Cl)c(c(c1)Cl)/C=C(/C(=O)O)\C)C |
Complexity: | 822 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 1 |
Defined Bond Stereocenter Count: | 1 |
Heavy Atom Count: | 39 |
Hydrogen Bond Acceptor Count: | 7 |
Hydrogen Bond Donor Count: | 2 |
Rotatable Bond Count: | 13 |
XLogP3: | 7.7 |
2-Propenoic acid, 3-[2,6-dichloro-4-[[[4-[3-[(1S)-1-(hexyloxy)ethyl]-2-methoxyphenyl]-2-thiazolyl]amino]carbonyl]phenyl]-2-methyl-, (2E)- is a versatile compound widely used in chemical synthesis due to its unique structure and reactivity. Its application in synthesis plays a crucial role in creating complex organic molecules with specific properties and functions.This compound serves as a key building block in the preparation of various pharmaceuticals, agrochemicals, and functional materials. Its presence in chemical reactions allows for the introduction of specific functionalities and structural motifs, leading to the formation of novel compounds with tailored properties.In chemical synthesis, 2-Propenoic acid, 3-[2,6-dichloro-4-[[[4-[3-[(1S)-1-(hexyloxy)ethyl]-2-methoxyphenyl]-2-thiazolyl]amino]carbonyl]phenyl]-2-methyl-, (2E)- acts as a strategic intermediate that undergoes diverse transformations to yield desired products. Its reactivity with various reagents and catalytic systems enables the construction of intricate molecular frameworks and the synthesis of complex molecules with high efficiency.Overall, the use of 2-Propenoic acid, 3-[2,6-dichloro-4-[[[4-[3-[(1S)-1-(hexyloxy)ethyl]-2-methoxyphenyl]-2-thiazolyl]amino]carbonyl]phenyl]-2-methyl-, (2E)- in chemical synthesis is vital for the development of innovative materials, pharmaceuticals, and functional molecules that have a wide range of applications in different industries.
Experimental hematology 20180301
Internal medicine (Tokyo, Japan) 20171101
Clinical journal of gastroenterology 20170101
Nihon Shokakibyo Gakkai zasshi = The Japanese journal of gastro-enterology 20170101
Drugs 20160101