logo
Home  > (E)-3,5-Dichloro-4-(3-ethoxy-2-methyl-3-oxoprop-1-en-1-yl)benzoic acid

AE19525

1110767-89-9 | (E)-3,5-Dichloro-4-(3-ethoxy-2-methyl-3-oxoprop-1-en-1-yl)benzoic acid

Packsize Purity Availability Price Discounted Price    Quantity
1g 95% in stock $173.00 $121.00 -   +
5g 95% in stock $440.00 $308.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AE19525
Chemical Name: (E)-3,5-Dichloro-4-(3-ethoxy-2-methyl-3-oxoprop-1-en-1-yl)benzoic acid
CAS Number: 1110767-89-9
Molecular Formula: C13H12Cl2O4
Molecular Weight: 303.138
MDL Number: MFCD29918463
SMILES: CCOC(=O)/C(=C/c1c(Cl)cc(cc1Cl)C(=O)O)/C

 

Upstream Synthesis Route 
  • The (E)-3,5-Dichloro-4-(3-ethoxy-2-methyl-3-oxoprop-1-en-1-yl)benzoic acid is a versatile compound widely used in chemical synthesis. Primarily, it serves as a key intermediate in the production of various pharmaceuticals, agrochemicals, and organic compounds due to its unique functional groups and reactivity. In organic synthesis, this compound acts as a crucial building block for creating more complex molecules through various reactions such as esterification, condensation, and substitution. Its structural features make it a valuable tool for creating diverse molecular structures with specific stereochemistry and functional groups, making it indispensable in the development of new chemical entities.
FEATURED PRODUCTS