AI08664
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $89.00 | $62.00 | - + | |
1g | 98% | in stock | $201.00 | $141.00 | - + | |
5g | 98% | in stock | $556.00 | $390.00 | - + | |
10g | 98% | in stock | $945.00 | $661.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI08664 |
Chemical Name: | 3-Chloro-5-hydroxymethylphenylboronic acid, pinacol ester |
CAS Number: | 1112210-59-9 |
Molecular Formula: | C13H18BClO3 |
Molecular Weight: | 268.5442 |
MDL Number: | MFCD18374004 |
SMILES: | OCc1cc(Cl)cc(c1)B1OC(C(O1)(C)C)(C)C |
Complexity: | 293 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
The compound $name$ plays a crucial role in chemical synthesis as a versatile building block. It exhibits unique reactivity due to the presence of the boronate ester group, enabling it to participate in various synthetic transformations. This compound is commonly employed as a key intermediate in the synthesis of pharmaceuticals, agrochemicals, and advanced materials. Its structural complexity and functional groups make it a valuable tool in developing new synthetic methodologies and designing novel molecular architectures. Through strategic manipulation of its chemical structure, researchers can access a wide range of derivatives with tailored properties for specific applications in the field of organic chemistry.