logo
Home  > Atorvastatin Di-acetonide tert-Butyl Ester

BG28602

1116118-82-1 | Atorvastatin Di-acetonide tert-Butyl Ester

Availability
Typically In Stock

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: BG28602
Chemical Name: Atorvastatin Di-acetonide tert-Butyl Ester
CAS Number: 1116118-82-1
Molecular Formula: C50H64FN3O8
Molecular Weight: 854.0569
SMILES: O=C(C[C@H]1C[C@@H](CCn2c(C(C)C)c(c(c2c2ccc(cc2)F)c2ccccc2)C(=O)Nc2ccccc2)OC(O1)(C)C)NCC[C@@H]1C[C@H](CC(=O)OC(C)(C)C)OC(O1)(C)C

 

Upstream Synthesis Route
  • Atorvastatin Di-acetonide tert-Butyl Ester is a valuable compound widely utilized in chemical synthesis due to its versatile applications. This compound serves as a crucial intermediate in the synthesis of pharmaceuticals, agrochemicals, and specialty chemicals. Its unique structure and properties make it an essential building block in the production of various complex molecules. With its high reactivity and compatibility with a range of functional groups, Atorvastatin Di-acetonide tert-Butyl Ester enables efficient transformations and diversifications in synthetic routes. Demonstrating excellent solubility and stability, this compound facilitates precise control over reaction conditions, leading to enhanced yields and purity of the final products. Its significance in organic synthesis cannot be overstated, as it plays a pivotal role in the creation of innovative compounds with potential applications in healthcare, agriculture, and materials science.
FEATURED PRODUCTS