AB52996
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $48.00 | $34.00 | - + | |
250mg | 98% | in stock | $80.00 | $56.00 | - + | |
1g | 98% | in stock | $176.00 | $123.00 | - + | |
5g | 98% | in stock | $813.00 | $569.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB52996 |
Chemical Name: | Boc-alpha-methyl-L-phenylalanine |
CAS Number: | 111771-58-5 |
Molecular Formula: | C15H21NO4 |
Molecular Weight: | 279.3315 |
MDL Number: | MFCD02682284 |
SMILES: | OC(=O)[C@@](Cc1ccccc1)(NC(=O)OC(C)(C)C)C |
The (R)-2-[(tert-Butoxycarbonyl)amino]-2-methyl-3-phenylpropionic acid, also known as $name$, is a versatile compound widely used in chemical synthesis. This compound plays a crucial role as a chiral building block in the synthesis of various pharmaceuticals, agrochemicals, and specialty chemicals. Its specific stereochemistry and functional groups make it a valuable intermediate in the production of complex molecules with high optical purity.One of the key applications of (R)-2-[(tert-Butoxycarbonyl)amino]-2-methyl-3-phenylpropionic acid is in the synthesis of chiral drugs and biologically active compounds. By incorporating this compound into the molecular structure of target molecules, chemists can introduce chirality and control the spatial arrangement of atoms, thereby influencing the pharmacological properties and biological activities of the final product. This compound serves as a starting material for the synthesis of various amino acids, peptides, and heterocyclic compounds, making it an essential building block in the pharmaceutical industry.Furthermore, the (R)-2-[(tert-Butoxycarbonyl)amino]-2-methyl-3-phenylpropionic acid is also utilized in asymmetric synthesis as a chiral auxiliary or ligand. Its unique structure allows for the creation of enantiomerically pure compounds through stereoselective reactions. By leveraging the chiral properties of this compound, chemists can control the stereochemistry of reactions, leading to the formation of single enantiomers with high efficiency and selectivity.In summary, the (R)-2-[(tert-Butoxycarbonyl)amino]-2-methyl-3-phenylpropionic acid is a valuable tool in chemical synthesis, particularly in the production of chiral compounds with diverse applications in pharmaceutical, agricultural, and material science sectors. Its utility in asymmetric synthesis, drug development, and molecular design highlights its significance as a key component in modern organic chemistry research and industrial processes.