logo
Home  > (S)-(-)-3,3'-Dibromo-1,1'-bi-2-naphthol

AE09884

111795-43-8 | (S)-(-)-3,3'-Dibromo-1,1'-bi-2-naphthol

Packsize Purity Availability Price Discounted Price    Quantity
1g 95% in stock $72.00 $50.00 -   +
5g 95% in stock $353.00 $247.00 -   +
10g 95% in stock $628.00 $440.00 -   +
25g 95% in stock $1,226.00 $858.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AE09884
Chemical Name: (S)-(-)-3,3'-Dibromo-1,1'-bi-2-naphthol
CAS Number: 111795-43-8
Molecular Formula: C20H12Br2O2
Molecular Weight: 444.1161
MDL Number: MFCD03093629
SMILES: Brc1cc2ccccc2c(c1O)c1c(O)c(Br)cc2c1cccc2

 

Upstream Synthesis Route 
  • (R)-3,3'-Dibromo-1,1'-bi-2-naphthol, also known as $name$, is a valuable chiral ligand used in chemical synthesis. With its unique structure and properties, this compound plays a crucial role in asymmetric catalysis and enantioselective transformations. When (R)-3,3'-Dibromo-1,1'-bi-2-naphthol is employed as a ligand, it effectively promotes various reactions by aligning the participating molecules in a specific orientation, leading to the selective formation of desired enantiomers. This compound has proven to be particularly useful in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals where chirality is essential for the desired biological activity or product efficacy. Its application in asymmetric catalysis opens up new avenues for creating complex molecules with high selectivity and efficiency.
FEATURED PRODUCTS