logo
Home  > 4-((tert-Butoxycarbonyl)(ethyl)amino)butanoic acid

AE21058

1121527-35-2 | 4-((tert-Butoxycarbonyl)(ethyl)amino)butanoic acid

Packsize Purity Availability Price Discounted Price    Quantity
50mg 95% 1 week $257.00 $180.00 -   +
100mg 95% 1 week $344.00 $241.00 -   +
250mg 95% 1 week $458.00 $321.00 -   +
500mg 95% 1 week $803.00 $563.00 -   +
1g 95% 1 week $1,043.00 $730.00 -   +
2.5g 95% 1 week $1,971.00 $1,380.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AE21058
Chemical Name: 4-((tert-Butoxycarbonyl)(ethyl)amino)butanoic acid
CAS Number: 1121527-35-2
Molecular Formula: C11H21NO4
Molecular Weight: 231.2887
MDL Number: MFCD23701763
SMILES: CCN(C(=O)OC(C)(C)C)CCCC(=O)O

 

Upstream Synthesis Route
  • 4-((tert-Butoxycarbonyl)(ethyl)amino)butanoic acid, also known as Boc-ethyl-amino butyric acid, is a versatile compound widely used in chemical synthesis. This compound serves as a key building block in the synthesis of peptides and other organic molecules due to its unique properties.In chemical synthesis, this compound is often utilized as a protecting group for the amino group. The tert-butoxycarbonyl (Boc) group can be selectively removed under mild conditions, allowing for the controlled deprotection of the amino group without affecting other functional groups in the molecule. This enables chemists to protect sensitive functional groups during various synthetic steps and selectively deprotect them at a later stage.Additionally, the ethyl group in the structure provides flexibility in the molecule's conformation and can influence the compound's solubility and reactivity. This can be advantageous in the design and synthesis of novel molecules with specific properties.Overall, the application of 4-((tert-Butoxycarbonyl)(ethyl)amino)butanoic acid in chemical synthesis allows for the efficient and controlled synthesis of complex organic molecules, particularly in the field of peptide chemistry and drug development.
FEATURED PRODUCTS