AI08971
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $94.00 | $66.00 | - + | |
5g | 95% | in stock | $277.00 | $194.00 | - + | |
10g | 95% | in stock | $431.00 | $302.00 | - + | |
25g | 95% | in stock | $738.00 | $517.00 | - + | |
100g | 95% | in stock | $2,266.00 | $1,586.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI08971 |
Chemical Name: | 2-Methoxy-6-methyl-3-nitropyridine |
CAS Number: | 112163-03-8 |
Molecular Formula: | C7H8N2O3 |
Molecular Weight: | 168.15 |
MDL Number: | MFCD03095074 |
SMILES: | [O-][N+](=O)c1ccc(nc1OC)C |
Complexity: | 169 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 1 |
XLogP3: | 1.4 |
2-Methoxy-6-methyl-3-nitropyridine is a versatile compound utilized in chemical synthesis as a key building block for various pharmaceuticals, agrochemicals, and specialty chemicals. Its unique structure and properties make it an essential intermediate in the production of numerous functional materials.In organic synthesis, 2-Methoxy-6-methyl-3-nitropyridine serves as a crucial precursor for synthesizing complex molecules with specific biological activities or industrial applications. By undergoing various chemical transformations such as reduction, oxidation, and functional group interconversion, this compound can be modified to introduce different functionalities into the target molecules.One of the notable applications of 2-Methoxy-6-methyl-3-nitropyridine is in the synthesis of pharmaceutical compounds. The presence of the nitro group and the pyridine ring in its structure allows for the incorporation of these pharmacophores into drug candidates, thereby imparting desired biological properties such as antimicrobial, antiviral, or anti-inflammatory activity.Furthermore, this compound plays a crucial role in the development of agrochemicals due to its ability to act as a potent pesticide or herbicide intermediate. By modifying the chemical structure of 2-Methoxy-6-methyl-3-nitropyridine, chemists can design environmentally friendly and effective crop protection agents that target specific pests or weeds while minimizing adverse effects on non-target organisms.Overall, the strategic use of 2-Methoxy-6-methyl-3-nitropyridine in chemical synthesis enables researchers and industry professionals to access a diverse range of valuable compounds with applications spanning pharmaceuticals, agrochemicals, and specialty chemicals.