logo
Home  > (2,2,6-Trimethyl-3,4-dihydro-2h-chromen-4-yl)amine

AE13510

112225-62-4 | (2,2,6-Trimethyl-3,4-dihydro-2h-chromen-4-yl)amine

Packsize Purity Availability Price Discounted Price    Quantity
250mg 95% in stock $249.00 $175.00 -   +
1g 95% in stock $572.00 $400.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AE13510
Chemical Name: (2,2,6-Trimethyl-3,4-dihydro-2h-chromen-4-yl)amine
CAS Number: 112225-62-4
Molecular Formula: C12H17NO
Molecular Weight: 191.2695
MDL Number: MFCD09262260
SMILES: Cc1ccc2c(c1)C(N)CC(O2)(C)C

 

Upstream Synthesis Route 
  • The (2,2,6-trimethyl-3,4-dihydro-2H-chromen-4-yl)amine is a versatile compound that finds wide application in chemical synthesis. With its unique structure and properties, this amine serves as a valuable building block in the creation of various organic molecules. In chemical synthesis, it acts as a key intermediate in the formation of complex structures, enabling the construction of diverse chemical compounds through functional group transformations and derivatization reactions. Its presence facilitates the development of novel materials, pharmaceuticals, and agrochemicals by serving as a crucial component in synthetic routes. Additionally, (2,2,6-trimethyl-3,4-dihydro-2H-chromen-4-yl)amine plays a crucial role in the pharmaceutical industry, contributing to the synthesis of bioactive compounds and drug candidates with potential therapeutic applications.
FEATURED PRODUCTS