AD65221
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $36.00 | $26.00 | - + | |
5mg | 98% | in stock | $144.00 | $101.00 | - + | |
10mg | 98% | in stock | $216.00 | $152.00 | - + | |
25mg | 98% | in stock | $360.00 | $252.00 | - + | |
100mg | 98% | in stock | $1,268.00 | $888.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD65221 |
Chemical Name: | 20(R)-GINSENOSIDE Rh2 |
CAS Number: | 112246-15-8 |
Molecular Formula: | C36H62O8 |
Molecular Weight: | 622.8727 |
MDL Number: | MFCD22200425 |
SMILES: | OC[C@H]1O[C@@H](O[C@H]2CC[C@]3([C@H](C2(C)C)CC[C@@]2([C@@H]3C[C@@H](O)[C@H]3[C@@]2(C)CC[C@@H]3[C@@](CCC=C(C)C)(O)C)C)C)[C@@H]([C@H]([C@@H]1O)O)O |
The 20(R)-Ginsenoside Rh2 is a natural compound that has shown great potential in chemical synthesis applications. This unique molecule is derived from ginseng and possesses a complex structure that offers various opportunities for use in the development of new chemical processes and products. In chemical synthesis, 20(R)-Ginsenoside Rh2 can serve as a versatile building block for the creation of novel compounds with specific properties and functions. Its structural features make it a valuable tool for designing and producing structurally diverse molecules, thereby opening up possibilities for drug discovery, material science, and other areas of research. With its intriguing characteristics and promising potential, 20(R)-Ginsenoside Rh2 holds great promise as a key player in advancing the field of chemical synthesis.