AE11374
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | ≥98% | in stock | $34.00 | $24.00 | - + | |
5mg | ≥98% | in stock | $107.00 | $75.00 | - + | |
10mg | 98% | in stock | $150.00 | $105.00 | - + | |
25mg | 98%(HPLC) | in stock | $288.00 | $202.00 | - + | |
50mg | 98% | in stock | $380.00 | $266.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE11374 |
Chemical Name: | WAY-262611 |
CAS Number: | 1123231-07-1 |
Molecular Formula: | C20H22N4 |
Molecular Weight: | 318.4155 |
MDL Number: | MFCD20527803 |
SMILES: | NCC1CCN(CC1)c1nccc(n1)c1ccc2c(c1)cccc2 |
Complexity: | 393 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 24 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 3.4 |
Journal of medicinal chemistry 20091126