AE25673
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $53.00 | $38.00 | - + | |
1g | 98% | in stock | $131.00 | $92.00 | - + | |
5g | 98% | in stock | $430.00 | $301.00 | - + | |
10g | 98% | in stock | $648.00 | $454.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE25673 |
Chemical Name: | Methyl 6-hydroxy-1h-indole-3-carboxylate |
CAS Number: | 112332-97-5 |
Molecular Formula: | C10H9NO3 |
Molecular Weight: | 191.1834 |
MDL Number: | MFCD11617113 |
SMILES: | COC(=O)c1c[nH]c2c1ccc(c2)O |
Methyl 6-hydroxy-1H-indole-3-carboxylate serves as a versatile building block in organic synthesis due to its unique structure and reactivity. This compound is commonly used in the synthesis of various biologically active molecules such as pharmaceuticals, natural products, and agrochemicals. Its hydroxyl and carboxylate functional groups make it an essential intermediate in the preparation of indole derivatives through various chemical transformations.One of the key applications of Methyl 6-hydroxy-1H-indole-3-carboxylate is its involvement in the synthesis of indole alkaloids, which are known for their diverse biological activities. By utilizing this compound as a starting material, chemists can access a wide range of indole alkaloids through strategic functional group manipulations, cyclization reactions, and further derivatization.Additionally, Methyl 6-hydroxy-1H-indole-3-carboxylate can be utilized in the construction of complex heterocyclic scaffolds found in many drug molecules. Its presence in the synthesis of pharmaceutical compounds highlights its significance in drug discovery and development processes.Overall, the strategic incorporation of Methyl 6-hydroxy-1H-indole-3-carboxylate in chemical synthesis enables the efficient access to diverse indole-based compounds with potential applications in medicinal chemistry, material science, and other interdisciplinary fields.