logo
Home  > Sodium 3-aminobenzenesulfonate

AD38664

1126-34-7 | Sodium 3-aminobenzenesulfonate

Packsize Purity Availability Price Discounted Price    Quantity
250mg 98% in stock $31.00 $22.00 -   +
1g 98% in stock $77.00 $54.00 -   +
5g 98% in stock $267.00 $187.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AD38664
Chemical Name: Sodium 3-aminobenzenesulfonate
CAS Number: 1126-34-7
Molecular Formula: C6H6NNaO3S
Molecular Weight: 195.1715
MDL Number: MFCD00025275
SMILES: Nc1cccc(c1)S(=O)(=O)[O-].[Na+]

 

Upstream Synthesis Route
  • Sodium 3-aminobenzenesulfonate is a versatile chemical compound commonly used in chemical synthesis as a key building block for various organic reactions. This compound plays a crucial role in the preparation of dyes, pharmaceuticals, and other fine chemicals due to its unique chemical properties.In chemical synthesis, Sodium 3-aminobenzenesulfonate is often employed as a nucleophilic reagent in the formation of carbon-carbon and carbon-nitrogen bonds. It can participate in substitution reactions, diazonium coupling reactions, and various other transformations to create complex organic molecules. Additionally, its sulfonate group can act as a directing group in aromatic substitution reactions, allowing for selective functionalization of aromatic rings.Furthermore, Sodium 3-aminobenzenesulfonate can be utilized as a precursor in the synthesis of heterocyclic compounds, which are essential in the development of pharmaceuticals and agrochemicals. Its ability to undergo diverse transformations makes it a valuable tool in the hands of synthetic chemists seeking to construct intricate molecular frameworks.Overall, Sodium 3-aminobenzenesulfonate is a crucial component in modern chemical synthesis, enabling the creation of novel compounds with diverse applications in various industries.
FEATURED PRODUCTS