AD63590
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
10mg | 98% | in stock | $57.00 | $40.00 | - + | |
100mg | 98% | in stock | $78.00 | $54.00 | - + | |
250mg | 98% | in stock | $153.00 | $107.00 | - + | |
1g | 98% | in stock | $386.00 | $270.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD63590 |
Chemical Name: | Seratrodast |
CAS Number: | 112665-43-7 |
Molecular Formula: | C22H26O4 |
Molecular Weight: | 354.4394 |
MDL Number: | MFCD00875701 |
SMILES: | OC(=O)CCCCCC(C1=C(C)C(=O)C(=C(C1=O)C)C)c1ccccc1 |
NSC Number: | 759640 |
Complexity: | 633 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 26 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 8 |
Undefined Atom Stereocenter Count: | 1 |
XLogP3: | 4.4 |
Seratrodast, a potent thromboxane A2 receptor antagonist, finds a valuable application in chemical synthesis as a versatile building block for the preparation of various pharmaceutical compounds. Its unique structural features and pharmacological properties make it a key intermediate in the synthesis of novel drug candidates targeting inflammation, asthma, and other related conditions. By incorporating Seratrodast into synthetic pathways, chemists can access a diverse array of derivatives with tailored activities and improved pharmacokinetic profiles. Moreover, its selective inhibition of specific biochemical pathways offers opportunities for designing more effective and safer therapeutics. Through strategic utilization of Seratrodast in chemical synthesis, researchers can accelerate the discovery and development of innovative drugs for a wide range of medical applications.