AD63591
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $29.00 | $20.00 | - + | |
250mg | 98% | in stock | $35.00 | $25.00 | - + | |
1g | 95% | in stock | $78.00 | $55.00 | - + | |
5g | 95% | in stock | $389.00 | $273.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD63591 |
Chemical Name: | 1-(tert-Butoxycarbonyl)-3-fluoroazetidine-3-carboxylic acid |
CAS Number: | 1126650-67-6 |
Molecular Formula: | C9H14FNO4 |
Molecular Weight: | 219.2102 |
MDL Number: | MFCD15071784 |
SMILES: | O=C(N1CC(C1)(F)C(=O)O)OC(C)(C)C |
Complexity: | 291 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 3 |
XLogP3: | 0.7 |
The Journal of organic chemistry 20090306