logo
Home  > Silane,[[(1a,3b,5E,7E)-9,10-secocholesta-5,7,10(19)-triene-1,3-diyl]bis(oxy)]bis[(1,1-dimethylethyl)dimethyl-

AI68110

112670-85-6 | Silane,[[(1a,3b,5E,7E)-9,10-secocholesta-5,7,10(19)-triene-1,3-diyl]bis(oxy)]bis[(1,1-dimethylethyl)dimethyl-

Packsize Purity Availability Price Discounted Price    Quantity
100mg 2 weeks $427.00 $299.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AI68110
Chemical Name: Silane,[[(1a,3b,5E,7E)-9,10-secocholesta-5,7,10(19)-triene-1,3-diyl]bis(oxy)]bis[(1,1-dimethylethyl)dimethyl-
CAS Number: 112670-85-6
Molecular Formula: C39H72O2Si2
Molecular Weight: 629.1588
MDL Number: MFCD11977659
SMILES: CC(CCC[C@H]([C@H]1CC[C@@H]2[C@]1(C)CCCC2=CC=C1C[C@H](C[C@@H](C1=C)O[Si](C(C)(C)C)(C)C)O[Si](C(C)(C)C)(C)C)C)C

 

Upstream Synthesis Route
  • The silane compound, [(1a,3b,5E,7E)-9,10-secocholesta-5,7,10(19)-triene-1,3-diyl]bis(oxy)]bis[(1,1-dimethylethyl)dimethyl, finds significant application in chemical synthesis processes. It serves as a crucial reagent in various reactions, especially in organic chemistry. This particular silane compound plays a key role as a protecting group in the synthesis of complex organic molecules, providing stability and enabling selective reactions to occur. Additionally, its unique structure allows for precise manipulation of functional groups and stereochemistry during the synthesis of intricate chemical compounds.
FEATURED PRODUCTS