AI68110
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 2 weeks | $427.00 | $299.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI68110 |
Chemical Name: | Silane,[[(1a,3b,5E,7E)-9,10-secocholesta-5,7,10(19)-triene-1,3-diyl]bis(oxy)]bis[(1,1-dimethylethyl)dimethyl- |
CAS Number: | 112670-85-6 |
Molecular Formula: | C39H72O2Si2 |
Molecular Weight: | 629.1588 |
MDL Number: | MFCD11977659 |
SMILES: | CC(CCC[C@H]([C@H]1CC[C@@H]2[C@]1(C)CCCC2=CC=C1C[C@H](C[C@@H](C1=C)O[Si](C(C)(C)C)(C)C)O[Si](C(C)(C)C)(C)C)C)C |
The silane compound, [(1a,3b,5E,7E)-9,10-secocholesta-5,7,10(19)-triene-1,3-diyl]bis(oxy)]bis[(1,1-dimethylethyl)dimethyl, finds significant application in chemical synthesis processes. It serves as a crucial reagent in various reactions, especially in organic chemistry. This particular silane compound plays a key role as a protecting group in the synthesis of complex organic molecules, providing stability and enabling selective reactions to occur. Additionally, its unique structure allows for precise manipulation of functional groups and stereochemistry during the synthesis of intricate chemical compounds.