AD38151
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 98% | in stock | $40.00 | $28.00 | - + | |
5mg | 98% | in stock | $74.00 | $52.00 | - + | |
10mg | 98% | in stock | $146.00 | $102.00 | - + | |
25mg | 98% | in stock | $342.00 | $240.00 | - + | |
50mg | 98% | in stock | $489.00 | $342.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD38151 |
Chemical Name: | Iwr-1-endo |
CAS Number: | 1127442-82-3 |
Molecular Formula: | C25H19N3O3 |
Molecular Weight: | 409.4367 |
MDL Number: | MFCD18086875 |
SMILES: | O=C1N(c2ccc(cc2)C(=O)Nc2cccc3c2nccc3)C(=O)C2C1C1C=CC2C1 |
The compound rel-4-[(3aR,4S,7R,7aS)-1,3,3a,4,7,7a-Hexahydro-1,3-dioxo-4,7-methano-2H-isoindol-2-yl]-N-8-quinolinylbenzamide has found significant application in chemical synthesis as a key intermediate for the preparation of various complex organic molecules. This compound serves as a versatile building block in the synthesis of biologically active compounds and pharmaceuticals. Its unique structural features make it a valuable starting material for the construction of diverse molecular architectures through strategic synthetic methodologies. Researchers and chemists utilize this compound as a crucial component in the development of novel chemical entities with potential therapeutic applications.