AD75442
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $355.00 | $248.00 | - + | |
1g | 97% | in stock | $867.00 | $607.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AD75442 |
Chemical Name: | Diethyl 4-bromopyridine-2,6-dicarboxylate |
CAS Number: | 112776-83-7 |
Molecular Formula: | C11H12BrNO4 |
Molecular Weight: | 302.1213 |
MDL Number: | MFCD09910265 |
SMILES: | CCOC(=O)c1cc(Br)cc(n1)C(=O)OCC |
Diethyl 4-bromopyridine-2,6-dicarboxylate is a versatile compound that finds wide application in chemical synthesis, particularly in the field of pharmaceuticals and agrochemicals. This compound is valued for its ability to serve as a key building block in the creation of various biologically active molecules.One of the key applications of Diethyl 4-bromopyridine-2,6-dicarboxylate is in the synthesis of heterocyclic compounds, which are vital in the development of new drugs and pesticides. By incorporating this compound into the synthetic pathway, chemists can access a diverse array of functionalized pyridine derivatives, which exhibit potent biological activities.Furthermore, Diethyl 4-bromopyridine-2,6-dicarboxylate serves as a valuable intermediate in the construction of complex molecules with diverse pharmacological properties. Its unique structural features enable efficient functionalization at multiple positions, allowing for the introduction of various substituents that are crucial for enhancing the desired biological activities of the final molecules.In conclusion, the strategic utilization of Diethyl 4-bromopyridine-2,6-dicarboxylate in chemical synthesis enables the synthesis of novel compounds with potential applications in the development of pharmaceuticals and agrochemicals. Its versatility and utility make it an indispensable building block for accessing diverse molecular architectures with promising biological activities.