AE08199
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 95% | in stock | $15.00 | $10.00 | - + | |
1g | 95% | in stock | $16.00 | $11.00 | - + | |
5g | 95% | in stock | $30.00 | $21.00 | - + | |
25g | 95% | in stock | $70.00 | $49.00 | - + | |
100g | 95% | in stock | $169.00 | $118.00 | - + | |
500g | 95% | in stock | $556.00 | $390.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE08199 |
Chemical Name: | L-Gulono-1,4-lactone |
CAS Number: | 1128-23-0 |
Molecular Formula: | C6H10O6 |
Molecular Weight: | 178.14 |
MDL Number: | MFCD00064331 |
SMILES: | OC[C@@H]([C@H]1OC(=O)[C@H]([C@H]1O)O)O |
Complexity: | 181 |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 4 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 4 |
Rotatable Bond Count: | 2 |
XLogP3: | -2 |
L-(+)-Gulonic acid γ-lactone, also known as Vitamin C lactone, plays a crucial role in organic chemistry as a versatile building block in chemical synthesis. This compound serves as a precursor in the production of various important compounds and pharmaceuticals. In particular, L-(+)-Gulonic acid γ-lactone is commonly utilized in the synthesis of ascorbic acid (Vitamin C) through a series of chemical reactions. Its reactivity and molecular structure make it a valuable starting material for synthesizing bioactive molecules with therapeutic benefits. This compound's unique properties make it an indispensable component in the realm of organic synthesis, enabling the creation of innovative and impactful chemical structures with diverse potential applications.