logo
Home  > H-Lys(boc)-nh2 hcl

AI09062

112803-72-2 | H-Lys(boc)-nh2 hcl

Packsize Purity Availability Price Discounted Price    Quantity
100mg 98% in stock $25.00 $18.00 -   +
250mg 98% in stock $38.00 $27.00 -   +
1g 98% in stock $69.00 $49.00 -   +
5g 98% in stock $224.00 $157.00 -   +
10g 98% in stock $446.00 $312.00 -   +
25g 98% in stock $1,100.00 $770.00 -   +
100g 98% in stock $2,810.00 $1,967.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AI09062
Chemical Name: H-Lys(boc)-nh2 hcl
CAS Number: 112803-72-2
Molecular Formula: C11H24ClN3O3
Molecular Weight: 281.77956
MDL Number: MFCD00153446
SMILES: O=C(OC(C)(C)C)NCCCC[C@@H](C(=O)N)N.Cl

 

Upstream Synthesis Route 
  • Carbamic acid, N-[(5S)-5,6-diamino-6-oxohexyl]-, 1,1-dimethylethyl ester, hydrochloride (1:1) is a valuable compound used in various chemical synthesis applications. This compound serves as a versatile building block in the creation of complex organic molecules due to its unique structural features and reactivity. In chemical synthesis, Carbamic acid, N-[(5S)-5,6-diamino-6-oxohexyl]-, 1,1-dimethylethyl ester, hydrochloride (1:1) can be employed as a key intermediate for the synthesis of pharmaceuticals, agrochemicals, and other specialty chemicals. Its controlled release properties, stability, and compatibility with different reaction conditions make it a preferred choice for chemists seeking to introduce specific functional groups or structural motifs into their target molecules. With its ability to undergo various chemical transformations, this compound plays a crucial role in the efficient and precise construction of advanced organic compounds in the realm of chemical synthesis.
FEATURED PRODUCTS