logo
Home  > 4'-(4-Pyridyl)-2,2':6',2''-terpyridine

AD62284

112881-51-3 | 4'-(4-Pyridyl)-2,2':6',2''-terpyridine

Packsize Purity Availability Price Discounted Price    Quantity
100mg 97% in stock $10.00 $7.00 -   +
250mg 97% in stock $12.00 $9.00 -   +
25g 97% in stock $848.00 $593.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Request Bulk Quote
Description
Catalog Number: AD62284
Chemical Name: 4'-(4-Pyridyl)-2,2':6',2''-terpyridine
CAS Number: 112881-51-3
Molecular Formula: C20H14N4
Molecular Weight: 310.35196
MDL Number: MFCD00932037
SMILES: n1ccc(cc1)c1cc(nc(c1)c1ccccn1)c1ccccn1

 

Upstream Synthesis Route 
  • 2,2':6',2''-Terpyridine, 4'-(4-pyridinyl)- is a versatile compound widely used in chemical synthesis due to its unique structure and reactivity. This compound serves as a critical ligand in coordination chemistry, specifically in the formation of metal-terpyridine complexes. These complexes have various applications, including catalysis, sensing, and materials science. Additionally, 2,2':6',2''-Terpyridine, 4'-(4-pyridinyl)- is utilized in the development of functional materials such as molecular switches, luminescent materials, and liquid crystals. Its ability to coordinate with metal ions makes it a valuable building block in the design of novel molecular architectures with tailored properties.
FEATURED PRODUCTS