AE11528
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 99% | in stock | $40.00 | $28.00 | - + | |
5mg | 99% | in stock | $63.00 | $45.00 | - + | |
10mg | 99% | in stock | $81.00 | $57.00 | - + | |
25mg | 99% | in stock | $104.00 | $73.00 | - + | |
50mg | 99% | in stock | $177.00 | $124.00 | - + | |
100mg | 99% | in stock | $299.00 | $209.00 | - + | |
250mg | 99% | in stock | $566.00 | $397.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE11528 |
Chemical Name: | Amcasertib |
CAS Number: | 1129403-56-0 |
Molecular Formula: | C31H33N5O2S |
Molecular Weight: | 539.691 |
MDL Number: | MFCD30489231 |
SMILES: | CCN(CCNC(=O)c1c(C)[nH]c(c1C)/C=C1/C(=O)Nc2c1cc(cc2)c1csc(n1)c1ccccc1)CC |
Amcasertib, also known by its chemical name BBI608, is a potent and selective inhibitor of cancer stem cells. In chemical synthesis, Amcasertib plays a crucial role as a targeted therapy agent that specifically targets and disrupts the signaling pathways involved in the self-renewal and survival of cancer stem cells. This unique mechanism of action makes Amcasertib a promising candidate for use in the development of novel anti-cancer drug compounds.The application of Amcasertib in chemical synthesis extends beyond its direct anti-cancer properties. By targeting specific molecular pathways related to stem cell maintenance, Amcasertib can provide valuable insights into understanding the fundamental mechanisms underlying cancer development and progression. This knowledge can be leveraged in the design and synthesis of innovative drug molecules with enhanced efficacy and reduced toxicity profiles.Furthermore, the ability of Amcasertib to selectively inhibit cancer stem cells opens up new possibilities for combination therapies and personalized treatment approaches. By integrating Amcasertib into multi-drug regimens, researchers can potentially enhance the overall effectiveness of cancer treatments and overcome drug resistance mechanisms. In summary, the unique pharmacological properties of Amcasertib make it a valuable tool in advancing the field of chemical synthesis for cancer therapy.