logo
Home  > Physalin L

AE18187

113146-74-0 | Physalin L

Packsize Purity Availability Price Discounted Price    Quantity
5mg 95% 2 weeks $729.00 $510.00 -   +
10mg 95% 2 weeks $1,015.00 $710.00 -   +

*All products are for research use only and not intended for human or animal use.

*All prices are in USD.

Description
Catalog Number: AE18187
Chemical Name: Physalin L
CAS Number: 113146-74-0
Molecular Formula: C28H32O10
Molecular Weight: 528.5477
MDL Number: MFCD22125016
SMILES: OC1C=C2C=CCC(=O)C2(C2C1C1(O)OC34C(C1=O)C1(C)CC(C4(C)OC(=O)C3(CC2)O)OC(=O)C1C)C

 

Upstream Synthesis Route
  • Physalin L is a naturally occurring compound that has gained attention for its potential use in chemical synthesis. This compound has shown promising applications in the field of organic chemistry due to its unique chemical structure and reactivity.Physalin L can be utilized as a starting material or intermediate in the synthesis of various complex organic molecules. Its interesting structural features make it a valuable building block for the creation of novel compounds with diverse properties and functionalities. Chemists can leverage the reactivity of Physalin L to introduce specific functional groups and modify its structure through various chemical transformations.Moreover, the presence of specific functional groups in Physalin L makes it an attractive candidate for the development of new synthetic methodologies. By leveraging the reactivity of these functional groups, chemists can design efficient and selective routes for the synthesis of target molecules, enabling the production of important compounds for pharmaceuticals, agrochemicals, and materials science.Overall, the application of Physalin L in chemical synthesis offers exciting opportunities for the discovery and development of innovative compounds with potential applications in various industries. By harnessing the unique properties of this natural product, researchers can advance the field of organic chemistry and contribute to the creation of valuable molecules with diverse functionalities.
FEATURED PRODUCTS