AX32172
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 95% | 1 week | $96.00 | $67.00 | - + | |
5mg | 95% | 1 week | $217.00 | $152.00 | - + | |
10mg | 95% | 1 week | $268.00 | $188.00 | - + | |
25mg | 95% | 1 week | $589.00 | $412.00 | - + | |
50mg | 95% | 1 week | $851.00 | $596.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AX32172 |
Chemical Name: | CGP78608Hydrochloride |
CAS Number: | 1135278-54-4 |
Molecular Formula: | C11H14BrClN3O5P |
Molecular Weight: | 414.5767 |
MDL Number: | MFCD00238674 |
SMILES: | Brc1cc(CN[C@@H](P(=O)(O)O)C)c2c(c1)[nH]c(=O)c(=O)[nH]2.Cl |
CGP 78608 Hydrochloride is a versatile chemical that finds application in various chemical synthesis processes. It serves as a highly effective catalyst in promoting specific reactions by facilitating the formation of key intermediates or transition states. This compound is particularly valued for its ability to enhance the rate and yield of complex organic transformations, making it a valuable tool for synthetic chemists striving to streamline their processes and achieve desired product outcomes. Additionally, CGP 78608 Hydrochloride demonstrates excellent compatibility with a wide range of substrates, enabling its use in diverse synthetic pathways. Its efficient catalytic properties make it a powerful asset in the arsenal of chemical synthesis practitioners seeking efficient and reliable methodologies for generating structurally intricate molecules.