AI09454
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1g | 95% | in stock | $58.00 | $41.00 | - + | |
5g | 95% | in stock | $226.00 | $159.00 | - + | |
10g | 95% | in stock | $421.00 | $295.00 | - + | |
25g | 95% | in stock | $870.00 | $609.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AI09454 |
Chemical Name: | 1-Methyl-5-nitro-1h-pyrrolo[2,3-b]pyridine |
CAS Number: | 1135437-92-1 |
Molecular Formula: | C8H7N3O2 |
Molecular Weight: | 177.1601 |
MDL Number: | MFCD19690176 |
SMILES: | [O-][N+](=O)c1cnc2c(c1)ccn2C |
Complexity: | 216 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 3 |
XLogP3: | 1.1 |
1-Methyl-5-nitro-1H-pyrrolo[2,3-b]pyridine, a powerful intermediate in chemical synthesis, serves as a versatile building block for various organic transformations. Its unique structural features make it an invaluable tool in the development of a wide range of novel molecules and materials. As a key component in synthetic routes, this compound plays a crucial role in the creation of pharmaceuticals, agrochemicals, and functionalized heterocyclic compounds. Its strategic placement in synthesis strategies allows for the introduction of essential functionalities and structural motifs, facilitating the synthesis of complex molecular architectures. By harnessing the reactivity and selectivity of 1-Methyl-5-nitro-1H-pyrrolo[2,3-b]pyridine, chemists can access a diverse array of chemical space, enabling the exploration of new avenues in drug discovery, materials science, and supramolecular chemistry.