AX64656
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
1mg | 95% | in stock | $557.00 | $390.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AX64656 |
Chemical Name: | Biotin-VAD-FMK |
CAS Number: | 1135688-15-1 |
Molecular Formula: | C30H49FN6O8S |
Molecular Weight: | 672.8089 |
MDL Number: | MFCD06799434 |
SMILES: | COC(=O)C[C@@H](C(=O)CF)NC(=O)[C@@H](NC(=O)[C@H](C(C)C)NC(=O)CCCCCNC(=O)CCCC[C@@H]1SC[C@H]2[C@@H]1NC(=O)N2)C |
Biotin-VAD-fmK is a versatile reagent widely used in chemical synthesis for the specific labeling of target proteins containing the caspase recognition sequence VAD. This specialized reagent allows for the precise identification and isolation of proteins that are cleaved by caspase enzymes, playing a crucial role in studying cellular apoptosis and related signaling pathways. By tagging these particular proteins with biotin, researchers can perform downstream analyses such as affinity purification, detection, and quantification, enabling a deeper understanding of apoptotic processes at the molecular level. Biotin-VAD-fmK thus serves as a valuable tool in the field of chemical biology and biochemistry, facilitating the investigation of protein cleavage events in various biological systems.