AA11614
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $70.00 | $49.00 | - + | |
250mg | 95% | in stock | $139.00 | $97.00 | - + | |
1g | 95% | in stock | $328.00 | $230.00 | - + | |
5g | 95% | in stock | $1,255.00 | $879.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA11614 |
Chemical Name: | 5-Methyl-2-phenylpyrazole-3-carboxylic acid |
CAS Number: | 1136-76-1 |
Molecular Formula: | C11H10N2O2 |
Molecular Weight: | 202.2093 |
MDL Number: | MFCD01693509 |
SMILES: | Cc1nn(c(c1)C(=O)O)c1ccccc1 |
Complexity: | 239 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 2.2 |
The compound 3-Methyl-1-phenyl-1H-pyrazole-5-carboxylic acid plays a crucial role in chemical synthesis as a versatile building block. It serves as a valuable intermediate compound in the production of various pharmaceuticals, agrochemicals, and organic compounds. With its unique molecular structure, this acid enables the synthesis of diverse derivatives through functional group transformations and reactions such as esterification, amidation, and cyclization. By incorporating 3-Methyl-1-phenyl-1H-pyrazole-5-carboxylic acid into organic synthesis routes, chemists can access a wide range of structurally diverse compounds with potential applications in medicinal chemistry, materials science, and other fields requiring tailored molecular design.