AB50393
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 95% | in stock | $82.00 | $57.00 | - + | |
250mg | 95% | in stock | $155.00 | $108.00 | - + | |
1g | 95% | in stock | $311.00 | $218.00 | - + | |
5g | 95% | in stock | $1,528.00 | $1,070.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AB50393 |
Chemical Name: | 4-((2-Hydroxyethoxy)carbonyl)benzoic acid |
CAS Number: | 1137-99-1 |
Molecular Formula: | C10H10O5 |
Molecular Weight: | 210.1834 |
MDL Number: | MFCD20259688 |
SMILES: | OCCOC(=O)c1ccc(cc1)C(=O)O |
4-((2-Hydroxyethoxy)carbonyl)benzoic acid, also known as HEBA, is a versatile compound widely utilized in chemical synthesis. This compound serves as a valuable building block in the creation of various pharmaceuticals, polymers, and materials due to its unique chemical properties.In chemical synthesis, HEBA is commonly employed as a key intermediate in the production of esters, amides, and other organic compounds. Its hydroxy and carboxylic acid functional groups enable it to participate in a range of chemical reactions, facilitating the modification of its structure to obtain desired derivatives. HEBA's ability to selectively react with different reagents makes it a valuable tool for synthesizing complex molecules with specific functionalities.Furthermore, HEBA is frequently utilized in the synthesis of prodrugs, where the compound is chemically modified to enhance its pharmacokinetic properties, such as solubility or stability. Its incorporation in drug development processes showcases its importance in pharmaceutical research and development.Overall, the application of 4-((2-Hydroxyethoxy)carbonyl)benzoic acid in chemical synthesis plays a crucial role in the creation of diverse organic compounds, making it a valuable component in the toolkit of synthetic chemists.