AE18283
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
100mg | 98% | in stock | $143.00 | $100.00 | - + | |
250mg | 98% | in stock | $246.00 | $172.00 | - + | |
1g | 98% | in stock | $655.00 | $458.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AE18283 |
Chemical Name: | Maleimidopropionyl-PEG10-NHS Ester |
CAS Number: | 1137109-22-8 |
Molecular Formula: | C34H55N3O17 |
Molecular Weight: | 777.8104 |
MDL Number: | MFCD20226950 |
SMILES: | O=C(CCN1C(=O)C=CC1=O)NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)ON1C(=O)CCC1=O |
The compound 2,5-Dioxo-1-pyrrolidinyl 37-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)-35-oxo-4,7,10,13,16,19,22,25,28,31-decaoxa-34-azaheptatriacontanoate is commonly used in chemical synthesis as a versatile building block. Its unique structure contributes to its utility in creating intricate molecular structures for pharmaceuticals, agrochemicals, and materials science. This compound plays a crucial role in the generation of diverse chemical libraries and the development of novel compounds with potential biological activity.