1137826-05-1 | 6-Hydroxyquinoline-3-carboxylic acid

Packsize	Purity	Availability	Price	Discounted Price
100mg	95%	in stock	$158.00	$110.00
250mg	95%	in stock	$169.00	$118.00
1g	95%	in stock	$392.00	$274.00
5g	95%	in stock	$1,178.00	$824.00
10g	95%	in stock	$1,878.00	$1,315.00

Description

• Catalog Number: AA12322
• Chemical Name: 6-Hydroxyquinoline-3-carboxylic acid
• CAS Number: 1137826-05-1
• Molecular Formula: C10H7NO3
• Molecular Weight: 189.1675
• MDL Number: MFCD18417138
• SMILES: Oc1ccc2c(c1)cc(cn2)C(=O)O

Upstream Synthesis Route

6-Hydroxyquinoline-3-carboxylic acid, also known as 6-HQC, is a versatile compound widely used in chemical synthesis. This compound serves as a key building block in the synthesis of various pharmaceuticals, agrochemicals, and fine chemicals. Its unique structure and functional groups make it a valuable intermediate in organic chemistry processes.In chemical synthesis, 6-Hydroxyquinoline-3-carboxylic acid is commonly employed as a precursor in the production of quinoline-based drugs and herbicides. It can undergo various reactions such as esterification, amidation, and condensation to form new chemical compounds with enhanced properties. Additionally, its ability to chelate metal ions makes it useful in coordination chemistry and bioinorganic chemistry research.Due to its versatile reactivity and compatibility with a wide range of reaction conditions, 6-Hydroxyquinoline-3-carboxylic acid is a highly sought-after compound in the field of medicinal chemistry and organic synthesis. Researchers and chemists rely on its unique properties to develop novel molecules with potential applications in the pharmaceutical and agricultural industries.