AA12320
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 98% | in stock | $38.00 | $27.00 | - + | |
1g | 98% | in stock | $100.00 | $70.00 | - + | |
5g | 98% | in stock | $347.00 | $243.00 | - + | |
25g | 98% | in stock | $1,356.00 | $949.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA12320 |
Chemical Name: | 5-Bromo-1-fluoro-3-methoxy-2-nitrobenzene |
CAS Number: | 1137869-91-0 |
Molecular Formula: | C7H5BrFNO3 |
Molecular Weight: | 250.0219 |
MDL Number: | MFCD20527806 |
SMILES: | COc1cc(Br)cc(c1[N+](=O)[O-])F |
Complexity: | 199 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 4 |
Rotatable Bond Count: | 1 |
XLogP3: | 2.5 |
The versatility of 5-Bromo-1-fluoro-3-methoxy-2-nitrobenzene in chemical synthesis is remarkable. This compound serves as a key building block in the creation of various pharmaceuticals, agrochemicals, and advanced materials. Its unique structure provides opportunities for functional group manipulation and enables the synthesis of diverse organic compounds. Furthermore, the presence of bromine, fluoro, methoxy, and nitro groups in this molecule imparts distinct reactivity, allowing for selective transformations in complex chemical reactions. Whether used as a precursor in drug development or a reagent in organic synthesis, 5-Bromo-1-fluoro-3-methoxy-2-nitrobenzene plays a pivotal role in the creation of novel molecules with valuable properties.