AA12385
Packsize | Purity | Availability | Price | Discounted Price | Quantity | |
---|---|---|---|---|---|---|
250mg | 97% | in stock | $7.00 | $5.00 | - + | |
1g | 97% | in stock | $9.00 | $6.00 | - + | |
5g | 97% | in stock | $35.00 | $25.00 | - + | |
10g | 97% | in stock | $44.00 | $31.00 | - + | |
25g | 95% | in stock | $51.00 | $36.00 | - + |
*All products are for research use only and not intended for human or animal use.
*All prices are in USD.
Catalog Number: | AA12385 |
Chemical Name: | 3,5-Di-tert-butylphenol |
CAS Number: | 1138-52-9 |
Molecular Formula: | C14H22O |
Molecular Weight: | 206.3239 |
MDL Number: | MFCD00008829 |
SMILES: | Oc1cc(cc(c1)C(C)(C)C)C(C)(C)C |
NSC Number: | 68209 |
Complexity: | 184 |
Covalently-Bonded Unit Count: | 1 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 1 |
Rotatable Bond Count: | 2 |
XLogP3: | 4.9 |
Molecules (Basel, Switzerland) 20101116
Bioorganic & medicinal chemistry letters 20101101
The journal of physical chemistry. A 20100325
The Journal of organic chemistry 20070928
Journal of the American Chemical Society 20060111
The Journal of organic chemistry 20050527
Journal of medicinal chemistry 20020718
Shokuhin eiseigaku zasshi. Journal of the Food Hygienic Society of Japan 20011201
Inorganic chemistry 20010702